Content deleted Content added
No edit summary |
m Open access bot: pmc updated in citation with #oabot. |
||
(35 intermediate revisions by 29 users not shown) | |||
Line 1:
{{More citations needed|date=January 2021}}
{{chembox
| Watchedfields = changed
| verifiedrevid = 420135264
|
|
| ImageSize = 180
| ImageName = Cinchonine | IUPACName = (9''S'')-Cinchonan-9-ol<ref>{{cite web |title=Common Chemistry - Substance Details - 118-10-5 : Cinchonan-9-ol, (9S)- |url=https://commonchemistry.org/ChemicalDetail.aspx?ref=118-10-5 |website=commonchemistry.org |accessdate=22 May 2020}}</ref><ref>{{BlueBook2013|rec=(Appendix 3, p. 1517)}}</ref>
| SystematicName = (''S'')-[(2''R'',4''S'',5''R'')-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl](quinolin-4-yl)methanol
| Section1 = {{Chembox Identifiers
| ChemSpiderID = 746392
| PubChem = 90454
| UNII_Ref = {{fdacite|correct|FDA}} | UNII = V43X79NZCD
| InChI = 1/C19H22N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,9,13-14,18-19,22H,1,8,10-12H2/t13-,14-,18-,19-/m0/s1
| InChIKey = KMPWYEUPVWOPIM-LSOMNZGLBY
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 496893
| EC_number = 204-234-6
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}▼
| ChEBI = 27509
| StdInChI = 1S/C19H22N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,9,13-14,18-19,22H,1,8,10-12H2/t13-,14-,18-,19-/m0/s1▼
| Beilstein = 89689
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}▼
▲ | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KMPWYEUPVWOPIM-LSOMNZGLSA-N▼
▲ | StdInChI = 1S/C19H22N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,9,13-14,18-19,22H,1,8,10-12H2/t13-,14-,18-,19-/m0/s1
| CASNo_Ref = {{cascite|correct|CAS}}▼
▲ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| CASNo = 118-10-5▼
▲ | StdInChIKey = KMPWYEUPVWOPIM-LSOMNZGLSA-N
| KEGG_Ref = {{keggcite|correct|kegg}}▼
▲ | CASNo_Ref = {{cascite|correct|CAS}}
| KEGG = C06528▼
▲ | CASNo = 118-10-5
| SMILES = n2c1c(cccc1)c(cc2)[C@H](O)[C@H]3N4CC[C@@H](C3)[C@@H](C=C)C4▼
▲ | KEGG_Ref = {{keggcite|correct|kegg}}
}}▼
▲ | KEGG = C06528
▲
}}
| Section2 = {{Chembox Properties
}}
| Section7 = {{Chembox Hazards
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|302|317|332}}
| PPhrases = {{P-phrases|261|264|270|271|272|280|301+312|302+352|304+312|304+340|312|321|330|333+313|363|501}}
▲ }}
}}
'''Cinchonine''' is an [[alkaloid]]
It is structurally similar to [[quinine]], an [[antimalarial]] drug.
It is a [[GLP-1 receptor agonist]] and therefore has potential as a possible treatment for obesity, type 2 diabetes, and [[non-alcoholic fatty liver disease]].<ref>{{cite journal |last1=Xue |first1=Huan |last2=Xing |first2=Hao-Jie |last3=Wang |first3=Bin |last4=Fu |first4=Chao |last5=Zhang |first5=Yu-Shan |last6=Qiao |first6=Xi |last7=Guo |first7=Chao |last8=Zhang |first8=Xiao-Li |last9=Hu |first9=Bin |last10=Zhao |first10=Xin |last11=Deng |first11=Li-Jiao |last12=Zhu |first12=Xiao-Chan |last13=Zhang |first13=Yi |last14=Liu |first14=Yun-Feng |title=Cinchonine, a Potential Oral Small-Molecule Glucagon-Like Peptide-1 Receptor Agonist, Lowers Blood Glucose and Ameliorates Non-Alcoholic Steatohepatitis |journal=Drug Design, Development and Therapy |date=11 May 2023 |volume=17 |pages=1417–1432 |doi=10.2147/DDDT.S404055 |url=https://www.dovepress.com/cinchonine-a-potential-oral-small-molecule-glucagon-like-peptide-1-rec-peer-reviewed-fulltext-article-DDDT |language=English|doi-access=free |pmc=10184894 }}</ref>
== References ==
<references />
[[Category:Quinuclidine alkaloids]]
[[Category:GLP-1 receptor agonists]]
▲[[Category:Alkaloids]]
▲[[Category:Quinolines]]
▲[[Category:Alcohols]]
{{alkaloid-stub}}
|