Jump to content

Bicinchoninic acid: Difference between revisions

From Wikipedia, the free encyclopedia
Browse history interactively
← Previous editNext edit →
Content deleted Content added
VisualWikitext
chembox cleanups
Line 4: Line 4:
| Name = Bicinchoninic acid
| Name = Bicinchoninic acid
| ImageFile = Structure of bicinchoninic acid.png
| ImageFile = Structure of bicinchoninic acid.png
| ImageSize = 200px
| ImageName =
| ImageName =
| PIN = [2,2′-Biquinoline]-4,4′-dicarboxylic acid
| PIN = [2,2′-Biquinoline]-4,4′-dicarboxylic acid
Line 32: Line 31:
| Solubility = Partially soluble in cold water, hot water{{vague|date=October 2013}}
| Solubility = Partially soluble in cold water, hot water{{vague|date=October 2013}}
| MeltingPtC = 352
| MeltingPtC = 352
| MeltingPt_notes = decomposes
| MeltingPt_note = decomposition
| BoilingPt =
| BoilingPt =
| pKa =
| pKa =

Revision as of 01:57, 11 May 2021

Bicinchoninic acid
Names
Preferred IUPAC name
[2,2′-Biquinoline]-4,4′-dicarboxylic acid
Other names
Bicinchoninic acid
4,4′-Dicarboxy-2,2′-biquinoline
2,2'-Biquinoline-4,4'-dicarboxylic acid
Identifiers
3D model (JSmol)
ChEMBL
ChemSpider
ECHA InfoCard 100.013.628 Edit this at Wikidata
UNII
  • InChI=1S/C20H12N2O4/c23-19(24)13-9-17(21-15-7-3-1-5-11(13)15)18-10-14(20(25)26)12-6-2-4-8-16(12)22-18/h1-10H,(H,23,24)(H,25,26) checkY
    Key: AFYNADDZULBEJA-UHFFFAOYSA-N checkY
  • O=C(O)c1cc(nc2c1cccc2)c3nc4ccccc4c(c3)C(=O)O
Properties
C20H12N2O4
Molar mass 344.326 g·mol−1
Appearance Cream colored powder
Odor Characteristic odor[vague]
Melting point 352 °C (666 °F; 625 K) decomposes
Partially soluble in cold water, hot water[vague]
Hazards
Occupational safety and health (OHS/OSH):
Main hazards
 Will irritate eyes and mucous membranes.
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 1: Exposure would cause irritation but only minor residual injury. E.g. turpentineFlammability (red): no hazard codeInstability (yellow): no hazard codeSpecial hazards (white): no code
1
Safety data sheet (SDS) External MSDS
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
checkY verify (what is checkY☒N ?)

Bicinchoninic acid /baɪsɪnkɔːnɪnɪk/ is a weak acid composed of two carboxylated quinoline rings.

Bicinchoninic is an organic compound with the formula (C9H5CO2H)2. The molecule consists of a pair of quinoline rings, each bearing a carboxylic acid group. Its sodium salt forms a purple complex with cuprous ions.[1][2][3]

Bicinchoninic acid is most commonly employed in the bicinchoninic acid (BCA) assay, which is used to determine the total level of protein in a solution. Bicinchoninic acid is used to analyze to monitor cuprous ion presence due to its purple coloration via a biuret reactionIn this assay, two molecules of bicinchoninic acid chelate a single Cu+ ion, forming a purple water-soluble complex that strongly absorbs light at 562 nm.[4]

References

  1. ^ "Measurement of Protein Using Bicinchoninic Acid". Analytical Biochemistry. 150 (1): 76–85. 1985. doi:10.1016/0003-2697(85)90442-7.
  2. ^ . doi:10.1016/0003-2697(89)90101-2. {{cite journal}}: Cite journal requires |journal= (help); Missing or empty |title= (help)
  3. ^ . doi:10.1016/S0076-6879(09)63008-1. {{cite journal}}: Cite journal requires |journal= (help); Missing or empty |title= (help)
  4. ^ Pierce BCA Protein Assay Kit
Retrieved from "https://en.wikipedia.org/w/index.php?title=Bicinchoninic_acid&oldid=1022537662"