Jump to content

Glucose 1-phosphate: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi
Last name has to be capitalized
 
(33 intermediate revisions by 23 users not shown)
Line 1: Line 1:
{{unreferenced|date=June 2010}}
{{chembox
{{chembox
| Watchedfields = changed
| verifiedrevid = 443836799
| verifiedrevid = 443837963
| ImageFile = Glucose 1-phosphate.svg
| ImageFile = Glucose 1-phosphate.svg
| ImageSize = 150px
| ImageSize = 150px
| ImageCaption = Anionic form of α-<small>D</small>-glucose 1-phosphate
| ImageFile2 = Cori ester.gif
| ImageFile2 =Cori_ester.png
| ImageSize2 = 150px
| ImageSize2 = 150px
| IUPACName = Glucose 1-phosphate
| ImageCaption2 = Neutral form of α-<small>D</small>-glucose 1-phosphate
| IUPACName = <small>D</small>-Glucopyranosyl dihydrogen phosphate
| OtherNames =
| SystematicName = (2''Ξ'',3''R'',4''S'',5''S'',6''R'')-3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl dihydrogen phosphate
| Section1 = {{Chembox Identifiers
| OtherNames = Cori ester
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 388311
| ChemSpiderID = 388311
| InChI = 1/C6H13O9P/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5-,6?/m1/s1
| InChI = 1/C6H13O9P/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5-,6?/m1/s1
Line 19: Line 22:
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 59-56-3
| CASNo = 59-56-3
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem = 65533
| UNII = CIX3U01VAU
| ChEBI_Ref = {{ebicite|correct|EBI}}
| PubChem = 65533
| KEGG = C00103
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16077
| ChEBI = 16077
| SMILES = O=P(O)(OC1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)O
| SMILES = O=P(O)(OC1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)O
| MeSHName = glucose-1-phosphate
| MeSHName = glucose-1-phosphate
}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| C=6 | H=13 | O=9 | P=1
| Formula = C6H13O9P
| MolarMass = 260.136
| Appearance =
| Appearance =
| Density =
| Density =
| MeltingPt =
| MeltingPt =
| BoilingPt =
| BoilingPt =
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| Solubility =
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| AutoignitionPt =
| Autoignition =
}}
}}
}}
}}
'''Glucose 1-phosphate''' (also called '''cori ester''') is a [[glucose]] molecule with a [[phosphate]] group on the 1'-carbon.


'''Glucose 1-phosphate''' (also called '''Cori ester''') is a [[glucose]] molecule with a [[phosphate]] group on the 1'-carbon. It can exist in either the α- or β-[[anomer]]ic form.
==Reactions==

==Reactions of α-glucose 1-phosphate==
===Catabolic===
===Catabolic===
In [[glycogenolysis]], it is the direct product of the reaction in which [[glycogen phosphorylase]] cleaves off a [[molecule]] of [[glucose]] from a greater [[glycogen]] structure.
In [[glycogenolysis]], it is the direct product of the reaction in which [[glycogen phosphorylase]] cleaves off a [[molecule]] of [[glucose]] from a greater [[glycogen]] structure. A deficiency of muscle glycogen phosphorylase is known as [[glycogen storage disease type V]] (McArdle Disease).


To be utilized in cellular catabolism it must first be converted to [[glucose 6-phosphate]] by the [[enzyme]] [[phosphoglucomutase]] in a free equilibrium.<ref>{{Citation|last=Pelley|first=John W.|title=8 - Gluconeogenesis and Glycogen Metabolism|date=2012-01-01|url=http://www.sciencedirect.com/science/article/pii/B9780323074469000088|work=Elsevier's Integrated Review Biochemistry (Second Edition)|pages=67–73|editor-last=Pelley|editor-first=John W.|place=Philadelphia|publisher=W.B. Saunders|language=en|doi=10.1016/b978-0-323-07446-9.00008-8|isbn=978-0-323-07446-9|access-date=2020-12-16}}</ref><ref>{{Citation|last=Isselbacher|first=Kurt J.|title=Galactose-1-phosphate Uridyl Transferase|date=1965-01-01|url=http://www.sciencedirect.com/science/article/pii/B9780123956309501535|work=Methods of Enzymatic Analysis|pages=863–866|editor-last=Bergmeyer|editor-first=Hans-Ulrich|publisher=Academic Press|language=en|doi=10.1016/b978-0-12-395630-9.50153-5|isbn=978-0-12-395630-9|access-date=2020-12-16}}</ref><ref>{{Citation|last=Bergmeyer|first=Hans-Ulrich|title=d-Glucose-1-phosphate|date=1965-01-01|url=http://www.sciencedirect.com/science/article/pii/B9780123956309500244|work=Methods of Enzymatic Analysis|pages=131–133|editor-last=Bergmeyer|editor-first=Hans-Ulrich|publisher=Academic Press|language=en|doi=10.1016/b978-0-12-395630-9.50024-4|isbn=978-0-12-395630-9|access-date=2020-12-16|last2=Klotzsch|first2=Helmut}}</ref> One reason that cells form glucose 1-phosphate instead of glucose during glycogen breakdown is that the very polar phosphorylated glucose cannot leave the cell membrane and so is marked for intracellular catabolism. [[PGM1|Phosphoglucomutase-1]] deficiency is known as [[glycogen storage disease]] type 14 (GSD XIV).<ref>[http://www.orpha.net/consor/cgi-bin/OC_Exp.php?Expert=711 Orphanet: Glycogen storage disease due to phosphoglucomutase deficiency]</ref>
To be utilized in cellular catabolism it must first be converted to [[glucose 6-phosphate]] by the [[enzyme]] [[phosphoglucomutase]]. One reason that cells form glucose 1-phosphate instead of glucose during glycogen breakdown is that the very polar phosphorylated glucose cannot leave the cell membrane and so is marked for intracellular catabolism.


===Anabolic===
===Anabolic===
In [[glycogenesis]], free glucose 1-phosphate can also react with [[UTP]] to form [[UDP-glucose]], by using the enzyme [[UDP-glucose pyrophosphorylase]]. It can then return to the greater glycogen structure via [[glycogen synthase]].
In [[glycogenesis]], free glucose 1-phosphate can also react with [[Uridine triphosphate|UTP]] to form [[UDP-glucose]],<ref name=":0">{{Citation|last=Blanco|first=Antonio|title=Chapter 19 - Integration and Regulation of Metabolism|date=2017-01-01|url=http://www.sciencedirect.com/science/article/pii/B9780128035504000197|work=Medical Biochemistry|pages=425–445|editor-last=Blanco|editor-first=Antonio|publisher=Academic Press|language=en|doi=10.1016/b978-0-12-803550-4.00019-7|isbn=978-0-12-803550-4|access-date=2020-12-16|last2=Blanco|first2=Gustavo|editor2-last=Blanco|editor2-first=Gustavo}}</ref> by using the enzyme [[UDP-glucose pyrophosphorylase]]. It can then return to the greater glycogen structure via [[glycogen synthase]].<ref name=":0" />

==β-Glucose 1-phosphate==
β-Glucose 1-phosphate is found in some microbes. It is produced by inverting α-glucan phosphorylases including [[maltose phosphorylase]], [[kojibiose phosphorylase]] and [[Alpha,alpha-trehalose phosphorylase|trehalose phosphorylase]] and is then converted into [[glucose 6-phosphate]] by [[beta-phosphoglucomutase|β-phosphoglucomutase]].


==See also==
==See also==
* [[Pentose phosphate pathway]]
* [[Pentose phosphate pathway]]
* [[Gerty Cori]]


==References==
[[Category:Organophosphates]]
{{reflist}}
[[Category:Monosaccharide derivatives]]


{{biochem-stub}}
{{Glycogenesis and glycogenolysis metabolic intermediates}}
{{Glycogenesis and glycogenolysis metabolic intermediates}}
{{Fructose and galactose metabolic intermediates}}
{{Fructose and galactose metabolic intermediates}}


[[Category:Organophosphates]]
[[de:Glucose-1-phosphat]]
[[Category:Monosaccharide derivatives]]
[[es:Glucosa-1-fosfato]]
[[Category:Phosphate esters]]
[[ja:グルコース-1-リン酸]]
[[ru:Глюкозо-1-фосфат]]